CAS 805946-43-4

2-(2,4,6-Trimethylphenyl)ethenesulfonic acid

Description:

2-(2,4,6-Trimethylphenyl)ethenesulfonic acid, with the CAS number 805946-43-4, is an organic compound characterized by its sulfonic acid functional group attached to an ethenyl group, which is further substituted with a 2,4,6-trimethylphenyl moiety. This compound typically exhibits strong acidity due to the presence of the sulfonic acid group, making it a potent proton donor in chemical reactions. It is likely to be soluble in polar solvents, such as water and alcohols, while exhibiting limited solubility in non-polar solvents. The presence of the bulky trimethylphenyl group may influence its steric properties and reactivity, potentially affecting its interactions in various chemical environments. This compound may find applications in organic synthesis, catalysis, or as a reagent in various chemical processes. Additionally, its unique structure could impart specific optical or electronic properties, making it of interest in materials science or pharmaceuticals. However, detailed safety and handling information should be consulted due to the potential hazards associated with sulfonic acids.

Formula: C₁₁H₁₄O₃S

InChI: InChI=1S/C11H14O3S/c1-8-6-9(2)11(10(3)7-8)4-5-15(12,13)14/h4-7H,1-3H3,(H,12,13,14)

InChI key: InChIKey=NGHWBBONFBLYNE-UHFFFAOYSA-N

SMILES: C(=CS(=O)(=O)O)C1=C(C)C=C(C)C=C1C

Synonyms:

• Ethenesulfonic acid, 2-(2,4,6-trimethylphenyl)-
• 2-(2,4,6-Trimethylphenyl)ethenesulfonic acid