CAS 80596-51-6

5-Hydroxy-2,3-Dimethyl-1,4-naphthoquinone

Description:

5-Hydroxy-2,3-dimethyl-1,4-naphthoquinone, also known as vitamin K3 or menadione, is a synthetic compound that plays a crucial role in various biological processes, particularly in blood coagulation. This compound features a naphthoquinone structure, characterized by a fused ring system containing two aromatic rings and two ketone groups. Its hydroxyl group contributes to its reactivity and solubility in polar solvents. The presence of methyl groups at the 2 and 3 positions enhances its lipophilicity, allowing it to interact with lipid membranes. As a naphthoquinone derivative, it exhibits antioxidant properties, which can help mitigate oxidative stress in biological systems. Additionally, it is involved in electron transfer processes and can participate in redox reactions. While it is essential for certain biological functions, excessive amounts can lead to toxicity, highlighting the importance of regulated intake. Overall, 5-hydroxy-2,3-dimethyl-1,4-naphthoquinone is a significant compound in both biochemistry and pharmacology, with applications in dietary supplements and potential therapeutic uses.

Formula: C₁₂H₁₀O₃

InChI: InChI=1S/C12H10O3/c1-6-7(2)12(15)10-8(11(6)14)4-3-5-9(10)13/h3-5,13H,1-2H3

InChI key: InChIKey=WBPHCLSNRLPSPK-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(=O)C(C)=C1C)=CC=CC2O

Synonyms:

• 5-Hydroxy-2,3-Dimethyl-1,4-naphthoquinone
• 3-Methylplumbagin
• 5-Hydroxy-2,3-dimethyl-1,4-naphthalenedione
• 1,4-Naphthalenedione, 5-hydroxy-2,3-dimethyl-
• 2,3-Dimethyl-5-hydroxy-1,4-naphthoquinone