CAS 805994-90-5

4-{[(5-methylthiophen-2-yl)methyl]amino}benzoic acid

Description:

4-{[(5-methylthiophen-2-yl)methyl]amino}benzoic acid, with the CAS number 805994-90-5, is an organic compound characterized by its complex structure, which includes a benzoic acid moiety and a 5-methylthiophen-2-yl group. This compound features an amino group that connects the thiophene derivative to the benzoic acid, indicating potential for hydrogen bonding and interactions with biological targets. The presence of the methyl group on the thiophene ring contributes to its hydrophobic character, while the carboxylic acid functional group provides acidic properties, making it soluble in polar solvents. The compound may exhibit biological activity, potentially serving as a pharmaceutical intermediate or a lead compound in drug development. Its unique structure suggests it could interact with various biological pathways, making it of interest in medicinal chemistry. Additionally, the thiophene ring may impart electronic properties that influence its reactivity and stability. Overall, this compound represents a blend of aromatic and heterocyclic chemistry, with implications for further research and application in various fields.

Formula: C₁₃H₁₃NO₂S

InChI: InChI=1/C13H13NO2S/c1-9-2-7-12(17-9)8-14-11-5-3-10(4-6-11)13(15)16/h2-7,14H,8H2,1H3,(H,15,16)

SMILES: Cc1ccc(CNc2ccc(cc2)C(=O)O)s1

Synonyms:

• 4-{[(5-Methyl-2-thienyl)methyl]amino}benzoic acid
• Benzoic Acid, 4-[[(5-Methyl-2-Thienyl)Methyl]Amino]-

4-{[(5-methyl-2-thienyl)methyl]amino}benzoic acid

CAS: 805994-90-5

Formula: C₁₃H₁₃NO₂S

Purity: 95.0%

Molecular weight: 247.31

Ref: 10-F315817