CAS 806-29-1
:(6α,11β)-6,9-Difluoro-11,17,21-trihydroxypregna-1,4-diene-3,20-dione
Description:
The chemical substance "(6α,11β)-6,9-Difluoro-11,17,21-trihydroxypregna-1,4-diene-3,20-dione," commonly known as dexamethasone, is a synthetic glucocorticoid with anti-inflammatory and immunosuppressant properties. It is characterized by its steroidal structure, which includes a cyclopentanoperhydrophenanthrene core, and specific functional groups that contribute to its biological activity. The presence of fluorine atoms enhances its potency and metabolic stability. Dexamethasone is typically administered in various forms, including oral tablets, injections, and topical formulations, and is used to treat a range of conditions such as allergies, autoimmune disorders, and certain cancers. Its mechanism of action involves binding to glucocorticoid receptors, leading to the modulation of gene expression and subsequent anti-inflammatory effects. The substance is also known for its side effects, which can include weight gain, increased blood sugar levels, and potential suppression of the adrenal gland function with prolonged use. Overall, dexamethasone is a crucial therapeutic agent in modern medicine, particularly in managing inflammatory and autoimmune conditions.
Formula:C21H26F2O5
InChI:InChI=1S/C21H26F2O5/c1-18-5-3-11(25)7-14(18)15(22)8-13-12-4-6-20(28,17(27)10-24)19(12,2)9-16(26)21(13,18)23/h3,5,7,12-13,15-16,24,26,28H,4,6,8-10H2,1-2H3/t12-,13-,15-,16-,18-,19-,20-,21-/m0/s1
InChI key:InChIKey=ABUISBDTYAZRHY-RBKZJGKHSA-N
SMILES:F[C@@]12[C@]([C@]3([C@](C)(C[C@@H]1O)[C@](C(CO)=O)(O)CC3)[H])(C[C@H](F)C=4[C@]2(C)C=CC(=O)C4)[H]
Synonyms:- (6alpha,11beta)-6,9-Difluoro-11,17,21-trihydroxypregna-1,4-diene-3,20-dione
- (6α,11β)-6,9-Difluoro-11,17,21-trihydroxypregna-1,4-diene-3,20-dione
- 6,9-Difluoro-11,17,21-Trihydroxypregna-1,4-Diene-3,20-Dione
- 6-Α-Fluoro-Isoflupredone
- 6α,9-Difluoroprednisolone
- 6α,9α-Difluoroprednisolone
- NSC 77021
- Pregna-1,4-Diene-3,20-Dione, 6,9-Difluoro-11,17,21-Trihydroxy-, (6Alpha,11Beta)-
- Pregna-1,4-diene-3,20-dione, 6,9-difluoro-11,17,21-trihydroxy-, (6α,11β)-
- Pregna-1,4-diene-3,20-dione, 6α,9-difluoro-11β,17,21-trihydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-α-Fluoro-isoflupredone
CAS:Formula:C21H26F2O5Purity:97%Color and Shape:SolidMolecular weight:396.42496a,9a-Difluoroprednisolone
CAS:Controlled ProductApplications 6α,9α-Difluoroprednisolone has shown to increase metastases and increase glucocorticoid activity in C57/BL6 mice.
References Albert, D., Zeidman, I.: Cancer Res., 22, 1297 (1962)Formula:C21H26F2O5Color and Shape:White To Light BeigeMolecular weight:396.426-alpha-Fluoro-isoflupredone
CAS:Controlled Product6-alpha-Fluoro-isoflupredone is a fine chemical that belongs to the class of versatile building blocks. It is a complex compound that has the CAS No. 806-29-1. This product can be used for research purposes, as well as in the production of other chemicals and pharmaceuticals. 6-alpha-Fluoro-isoflupredone is also a useful building block for complex compounds, and it can be used as a reagent or speciality chemical for various reactions. It is also a useful intermediate for reaction components or scaffolds in organic synthesis.
Formula:C21H26F2O5Purity:Min. 96.0 Area-%Molecular weight:396.43 g/mol




