CAS 80604-16-6

(2S)-2-(2,6-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydro-4H-chromen-4-one

Description:

The chemical substance known as (2S)-2-(2,6-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydro-4H-chromen-4-one, with the CAS number 80604-16-6, is a flavonoid compound characterized by its complex polyphenolic structure. This compound features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of the chromone backbone is indicative of its classification within the flavonoid family, which is known for various biological activities, including anti-inflammatory, antimicrobial, and anticancer effects. The specific stereochemistry at the 2-position (2S) suggests that it may exhibit unique interactions with biological targets, influencing its pharmacological profile. Additionally, the dihydroxyphenyl substituent enhances its reactivity and solubility in polar solvents. Overall, this compound's structural features suggest it may have significant implications in medicinal chemistry and natural product research, warranting further investigation into its therapeutic potential and mechanisms of action.

Formula: C₁₅H₁₂O₆

InChI: InChI=1/C15H12O6/c16-7-4-10(19)15-11(20)6-13(21-12(15)5-7)14-8(17)2-1-3-9(14)18/h1-5,13,16-19H,6H2/t13-/m0/s1

SMILES: c1cc(c(c(c1)O)[C@@H]1CC(=O)c2c(cc(cc2O1)O)O)O

Synonyms:

• 2',5,6',7-Tetrahydroxyflavanone

2-(2,6-Dihydroxyphenyl)-5,7-dihydroxychroman-4-one

CAS: 80604-16-6

Formula: C₁₅H₁₂O₆

Purity: 97.5%

Molecular weight: 288.2522

Ref: IN-DA008M9T

2',5,6',7-Tetrahydroxyflavanone

CAS: 80604-16-6

(2S)-2',5,6',7-tetrahydroxyflavanone prevents lipid peroxidation in rat liver via ADP and NADPH inhibition.

Formula: C₁₅H₁₂O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 288.25

Ref: TM-TN2725

2',5,6',7-Tetrahydroxyflavanone

CAS: 80604-16-6

Formula: C₁₅H₁₂O₆

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 288.255

Ref: BP-SBP00398

2',5,6',7-Tetrahydroxyflavanone

CAS: 80604-16-6

2',5,6',7-Tetrahydroxyflavanone is a naturally occurring flavanone, which is a type of flavonoid compound. It is primarily sourced from various plant species, where it functions as a secondary metabolite. This compound exhibits significant antioxidant activity, which is mediated through its ability to scavenge free radicals and chelate metal ions, thereby mitigating oxidative stress at the cellular level.

Formula: C₁₅H₁₂O₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 288.25 g/mol

Ref: 3D-FDA60416