CAS 80604-68-8
:7-[[6-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-5-hydroxy-2-[3-(2-hydroxyethoxy)-4-methoxyphenyl]-4H-1-benzopyran-4-one
Description:
The chemical substance known as "7-[[6-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-5-hydroxy-2-[3-(2-hydroxyethoxy)-4-methoxyphenyl]-4H-1-benzopyran-4-one," with the CAS number 80604-68-8, is a complex flavonoid glycoside. This compound features a benzopyran backbone, which is characteristic of flavonoids, and is substituted with multiple sugar moieties, specifically a 6-deoxy-α-L-mannopyranosyl group and a β-D-glucopyranosyl group. The presence of hydroxyl groups contributes to its potential antioxidant properties, while the methoxy and hydroxyethoxy substituents may enhance its solubility and biological activity. Such compounds are often studied for their pharmacological effects, including anti-inflammatory and anti-cancer properties. The intricate structure suggests that it may interact with various biological targets, making it of interest in medicinal chemistry and natural product research. Further studies would be necessary to elucidate its specific biological activities and potential applications in therapeutics.
Formula:C30H36O16
InChI:InChI=1S/C30H36O16/c1-12-23(34)25(36)27(38)29(43-12)42-11-21-24(35)26(37)28(39)30(46-21)44-14-8-15(32)22-16(33)10-18(45-20(22)9-14)13-3-4-17(40-2)19(7-13)41-6-5-31/h3-4,7-10,12,21,23-32,34-39H,5-6,11H2,1-2H3/t12-,21+,23-,24+,25+,26-,27+,28+,29+,30+/m0/s1
InChI key:InChIKey=WPEGKIKHFSQQCA-WTNNCJBMSA-N
SMILES:O=C1C=2C(OC(=C1)C3=CC(OCCO)=C(OC)C=C3)=CC(O[C@@H]4O[C@H](CO[C@H]5[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O5)[C@@H](O)[C@H](O)[C@H]4O)=CC2O
Synonyms:- 4H-1-Benzopyran-4-one, 7-[[6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-5-hydroxy-2-[3-(2-hydroxyethoxy)-4-methoxyphenyl]-
- 3′-O-(β-Hydroxyethyl)diosmin
- 7-[[6-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-5-hydroxy-2-[3-(2-hydroxyethoxy)-4-methoxyphenyl]-4H-1-benzopyran-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
3'-O-(β-Hydroxyethyl)diosmin
CAS:Controlled ProductFormula:C30H36O16Color and Shape:NeatMolecular weight:652.597Ref: 4Z-H-025001
Discontinued product


