CAS 80613-04-3
:methyl 3-hydroxypiperidine-1-carboxylate
Description:
Methyl 3-hydroxypiperidine-1-carboxylate, identified by its CAS number 80613-04-3, is an organic compound characterized by a piperidine ring with a hydroxyl group and a carboxylate ester functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxyl group, which enhances its hydrophilicity. The compound is of interest in medicinal chemistry and pharmaceutical research due to its potential biological activities, including its role as a building block in the synthesis of various bioactive molecules. Its structure allows for various chemical modifications, making it versatile in synthetic applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, methyl 3-hydroxypiperidine-1-carboxylate is a valuable compound in organic synthesis and drug development.
Formula:C7H13NO3
InChI:InChI=1/C7H13NO3/c1-11-7(10)8-4-2-3-6(9)5-8/h6,9H,2-5H2,1H3
SMILES:COC(=O)N1CCCC(C1)O
Synonyms:- 1-Piperidinecarboxylic Acid, 3-Hydroxy-, Methyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
