
CAS 80615-55-0
:Methyl 3,4-diamino-2-thiophenecarboxylate
Description:
Methyl 3,4-diamino-2-thiophenecarboxylate is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features two amino groups (-NH2) at the 3 and 4 positions of the thiophene ring, contributing to its potential reactivity and biological activity. The presence of a carboxylate group (-COO-) indicates that it can participate in various chemical reactions, such as esterification or amidation. Methyl groups attached to the carboxylate enhance its solubility in organic solvents. This compound may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals, owing to the functional groups present. Additionally, the amino groups can engage in hydrogen bonding, influencing its physical properties like melting and boiling points. Overall, Methyl 3,4-diamino-2-thiophenecarboxylate is a versatile compound with applications in organic synthesis and medicinal chemistry, although specific applications would depend on further research and development.
Formula:C6H8N2O2S
InChI:InChI=1S/C6H8N2O2S/c1-10-6(9)5-4(8)3(7)2-11-5/h2H,7-8H2,1H3
InChI key:InChIKey=PZHNENDGTWNESN-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(N)C(N)=CS1
Synonyms:- 2-Thiophenecarboxylic acid, 3,4-diamino-, methyl ester
- Methyl 3,4-diamino-2-thiophenecarboxylate
- 3,4-Diamino-2-carbomethoxy-thiophene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.