CAS 80632-52-6
:Leu-Enkephalin (sulfated)
Description:
Leu-Enkephalin (sulfated), with the CAS number 80632-52-6, is a naturally occurring peptide that belongs to the class of endogenous opioid peptides. It is derived from the proenkephalin precursor and consists of a sequence of amino acids, specifically five amino acids in length, with the addition of a sulfate group that enhances its biological activity and stability. This modification can influence its interaction with opioid receptors, particularly the delta-opioid receptor, which plays a crucial role in pain modulation and various physiological processes. Leu-Enkephalin (sulfated) exhibits analgesic properties and is involved in the regulation of mood, stress response, and immune function. Its structure allows it to participate in neurotransmission and signal transduction pathways, contributing to its role in the central nervous system. The sulfation of the peptide can affect its solubility and binding affinity, making it an interesting subject for research in pharmacology and neurobiology. Overall, Leu-Enkephalin (sulfated) is significant for its potential therapeutic applications in pain management and neuropsychiatric disorders.
Formula:C28H37N5O10S
InChI:InChI=1/C28H37N5O10S/c1-17(2)12-23(28(38)39)33-27(37)22(14-18-6-4-3-5-7-18)32-25(35)16-30-24(34)15-31-26(36)21(29)13-19-8-10-20(11-9-19)43-44(40,41)42/h3-11,17,21-23H,12-16,29H2,1-2H3,(H,30,34)(H,31,36)(H,32,35)(H,33,37)(H,38,39)(H,40,41,42)/t21-,22-,23-/m0/s1
SMILES:CC(C)C[C@@H](C(=O)O)N=C([C@H](Cc1ccccc1)N=C(CN=C(CN=C([C@H](Cc1ccc(cc1)OS(=O)(=O)O)N)O)O)O)O
Synonyms:- H-Tyr(SO3H)-Gly-Gly-Phe-Leu-OH
- O-sulfo-L-tyrosylglycylglycyl-L-phenylalanyl-L-leucine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Leu-Enkephalin (sulfated)
CAS:Leu-Enkephalin (sulfated) H-Tyr(SO3H)-Gly-Gly-Phe-Leu-OH is an endogenous opioid peptide that has been found in the central nervous system. It was first discovered by radioimmunoassays of brain tissue and then later found to be present in other tissues. Leu-enkephalin is not acidic, but it can form a salt with sulfonic acid or carboxylate, which may account for its ability to bind to receptors on cell membranes. The molecular weight of leu-enkephalin is 921.5 daltons and it contains one sulfonation group and one glycosylation site. Leu-enkephalin (sulfated) H-Tyr(SO3H)-Gly-Gly-Phe-Leu-OH can be synthesized from the amino acids Glycine, Tyr(SOFormula:C28H37N5O10SPurity:Min. 95%Molecular weight:635.69 g/mol
