CymitQuimica logo

CAS 80632-54-8

:

1-(10-Acetyl-10H-phenothiazin-2-yl)-1-propanone

Description:
1-(10-Acetyl-10H-phenothiazin-2-yl)-1-propanone, with the CAS number 80632-54-8, is a chemical compound that belongs to the class of phenothiazine derivatives. This substance features a phenothiazine core, which is characterized by a sulfur and nitrogen-containing bicyclic structure, contributing to its unique chemical properties. The presence of an acetyl group enhances its reactivity and solubility in organic solvents. Typically, compounds of this nature exhibit biological activity, often being investigated for their potential pharmacological effects, including antipsychotic and anti-inflammatory properties. The molecular structure suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic additions, due to the functional groups present. Additionally, its stability and solubility can vary depending on the solvent and environmental conditions. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, this compound represents a significant area of interest in medicinal chemistry and drug development.
Formula:C17H15NO2S
InChI:InChI=1/C17H15NO2S/c1-3-15(20)12-8-9-17-14(10-12)18(11(2)19)13-6-4-5-7-16(13)21-17/h4-10H,3H2,1-2H3
InChI key:InChIKey=JWKIQDFPIATNFP-UHFFFAOYSA-N
SMILES:C(C)(=O)N1C=2C(SC=3C1=CC=CC3)=CC=C(C(CC)=O)C2
Synonyms:
  • 1-(10-acetyl-10H-phenothiazin-2-yl)propan-1-one
  • 1-Propanone, 1-(10-acetyl-10H-phenothiazin-2-yl)-
  • 10-Acetyl-2-propionyl-10H-phenothiazine
  • 10H-Phenothiazine, 10-acetyl-2-(1-oxopropyl)-
  • 1-(10-Acetyl-10H-phenothiazin-2-yl)-1-propanone
  • Phenothiazine, 10-acetyl-2-propionyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.