CAS 80638-54-6

2-[(2-Methoxyethyl)amino]-2-oxoacetic acid

Description:

2-[(2-Methoxyethyl)amino]-2-oxoacetic acid, with the CAS number 80638-54-6, is an organic compound characterized by its unique functional groups. It features an amino group, a methoxyethyl substituent, and a carboxylic acid moiety, which contribute to its polar nature and potential solubility in water. The presence of the oxo group (carbonyl) enhances its reactivity, making it a candidate for various chemical reactions, such as esterification or amidation. This compound may exhibit biological activity due to its structural similarity to amino acids and other biologically relevant molecules. Its methoxyethyl group can influence its lipophilicity and membrane permeability, potentially affecting its pharmacokinetic properties. Additionally, the compound's stability and reactivity can be influenced by pH and temperature, which are important considerations in both synthetic applications and biological contexts. Overall, 2-[(2-Methoxyethyl)amino]-2-oxoacetic acid is a versatile compound with potential applications in pharmaceuticals and biochemistry.

Formula: C₅H₉NO₄

InChI: InChI=1S/C5H9NO4/c1-10-3-2-6-4(7)5(8)9/h2-3H2,1H3,(H,6,7)(H,8,9)

InChI key: InChIKey=XUQDDHNFRFFREK-UHFFFAOYSA-N

SMILES: C(NCCOC)(C(O)=O)=O

Synonyms:

• Acetic acid, 2-[(2-methoxyethyl)amino]-2-oxo-
• Acetic acid, [(2-methoxyethyl)amino]oxo-
• 2-[(2-Methoxyethyl)amino]-2-oxoacetic acid

[(2-Methoxyethyl)carbamoyl]formic acid

CAS: 80638-54-6

Versatile small molecule scaffold

Formula: C₅H₉NO₄

Purity: Min. 95%

Molecular weight: 147.13 g/mol

Ref: 3D-FDA63854