CAS 8065-29-0
:Liotrix
Description:
Liotrix is a synthetic combination of two thyroid hormones, thyroxine (T4) and triiodothyronine (T3), used primarily in the treatment of hypothyroidism. It is designed to mimic the natural hormone levels in the body, providing a balanced approach to thyroid hormone replacement therapy. The substance is typically administered in tablet form and is characterized by its ability to enhance metabolic processes, regulate growth and development, and influence various physiological functions. Liotrix is often preferred in certain clinical scenarios where a more precise hormonal balance is required, as it combines both T4 and T3 in a specific ratio. Its pharmacokinetics involve absorption in the gastrointestinal tract, with peak levels occurring within a few hours post-administration. Side effects may include symptoms of hyperthyroidism if overdosed, such as increased heart rate, anxiety, and weight loss. As with any medication, it is essential for patients to be monitored regularly to ensure appropriate dosing and to mitigate potential adverse effects.
Formula:C15H12I3NO4·C15H11I4NO4·2Na
InChI:InChI=1S/C15H11I4NO4.C15H12I3NO4.2Na/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23;16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22;;/h1-2,4-5,12,21H,3,20H2,(H,22,23);1-4,6,12,20H,5,19H2,(H,21,22);;/t2*12-;;/m00../s1
InChI key:InChIKey=ZJLMKFOBPJZZFF-XOCLESOZSA-N
SMILES:O(C1=C(I)C=C(C[C@@H](C(O)=O)N)C=C1I)C2=CC(I)=C(O)C=C2.[Na].O(C1=CC(I)=C(O)C(I)=C1)C2=C(I)C=C(C[C@@H](C(O)=O)N)C=C2I.[Na]
Synonyms:- Liotrix
- L-Tyrosine, O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-, monosodium salt, mixt. with O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-L-tyrosine monosodium salt
- L-Tyrosine, O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-, monosodium salt, mixt. contg.
- Thyrolar
- L-Tyrosine, O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-, sodium salt (1:1), mixt. with O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-L-tyrosine sodium salt (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Liotrix
CAS:Controlled ProductFormula:C15H11I3NNaO4·C15H10I4NNaO4Color and Shape:NeatMolecular weight:1471.807Liotrix
CAS:<p>Liotrix is a drug that acts as an inhibitor of apoptosis and has been shown to have anticancer properties. It is derived from Chinese urine and works by inhibiting kinase activity, which is essential for the survival of cancer cells. Liotrix is an analog of quetiapine, a drug used to treat schizophrenia and bipolar disorder, and has been found to be effective against various types of tumors in human cancer cell lines. This drug specifically targets kinases, which are enzymes involved in the regulation of cellular processes such as growth and differentiation. By inhibiting these kinases, Liotrix can prevent the proliferation and survival of cancer cells, making it a promising candidate for the treatment of various forms of cancer.</p>Formula:C30H21I7N2Na2O8Purity:Min. 95%Molecular weight:1,471.8 g/mol

