CAS 8066-07-7
:[1S-[1α(2Z,4E),4α,6α]]-5-(4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]hept-1-yl)-3-methylpenta-2,4-dienal
Description:
The chemical substance with the name "[1S-[1α(2Z,4E),4α,6α]]-5-(4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]hept-1-yl)-3-methylpenta-2,4-dienal" and CAS number "8066-07-7" is a complex organic compound characterized by its unique bicyclic structure and multiple functional groups. It features a hydroxyl group, which contributes to its polarity and potential for hydrogen bonding, enhancing its solubility in polar solvents. The presence of conjugated double bonds in the penta-2,4-dienal moiety suggests that the compound may exhibit significant reactivity, particularly in electrophilic addition reactions. The stereochemistry indicated by the specific configuration at various chiral centers suggests that the compound may have distinct biological activity or interactions, making it of interest in fields such as medicinal chemistry or natural product synthesis. Additionally, the compound's structural complexity may influence its physical properties, such as melting and boiling points, as well as its stability under various conditions. Overall, this substance exemplifies the intricate nature of organic molecules and their potential applications in various scientific domains.
Formula:C15H22O3
InChI:InChI=1/C15H22O3/c1-11(6-8-16)5-7-15-13(2,3)9-12(17)10-14(15,4)18-15/h5-8,12,17H,9-10H2,1-4H3
InChI key:InChIKey=ZTALKMXOHWQNIA-TVBSHJCBSA-N
SMILES:C(=C/C(=C\C=O)/C)\[C@]12[C@](C)(O1)C[C@@H](O)CC2(C)C
Synonyms:- (-)-Xanthoxin
- (1S-(1alpha(2Z,4E),4alpha,6alpha))-5-(4-Hydroxy-2,2,6-trimethyl-7-oxabicyclo(4.1.0)hept-1-yl)-3-methylpenta-2,4-dienal
- (2Z,4E)-5-[(1S,4S,6R)-4-Hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]hept-1-yl]-3-methyl-2,4-pentadienal
- (2Z,4E)-5-[(1S,4S,6R)-4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]hept-1-yl]-3-methylpenta-2,4-dienal
- 2,4-Pentadienal, 5-(4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]hept-1-yl)-3-methyl-, [1S-[1α(2Z,4E),4α,6α]]-
- 2,4-Pentadienal, 5-[(1S,4S,6R)-4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]hept-1-yl]-3-methyl-, (2Z,4E)-
- 2-cis,4-trans-Xanthoxin
- 5-(4-Hydroxy-2,2,6-Trimethyl-7-Oxabicyclo[4.1.0]Heptan-1-Yl)-3-Methyl-Penta-2,4-Dienal
- 7-Oxabicyclo[4.1.0]heptane, 2,4-pentadienal deriv.
- Xanthoxal
- cis,trans-Xanthoxin
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Xanthoxin
CAS:Xanthoxin is a medicinal compound with potent anticancer properties. It has been shown to induce apoptosis, or programmed cell death, in cancer cells. Xanthoxin has been tested in various cancer cell lines, including Chinese and human cells, and has demonstrated strong inhibitory effects on the tumor cycle. This compound works by inhibiting kinases and other proteins involved in cancer cell growth and proliferation. Xanthoxin is also known to be an inhibitor of certain urinary proteins that are associated with cancer progression. Overall, Xanthoxin shows great potential as a natural product for the development of novel anticancer therapies.
Formula:C15H22O3Purity:Min. 95%Molecular weight:250.33 g/molRef: 3D-IAA06607
Discontinued product

