CAS 8067-46-7
:naphthalene-1,5-disulfonic acid - 1-(3,4-dichlorophenyl)-6,6-dimethyl-1,6-dihydro-1,3,5-triazine-2,4-diamine (1:1)
Description:
Naphthalene-1,5-disulfonic acid - 1-(3,4-dichlorophenyl)-6,6-dimethyl-1,6-dihydro-1,3,5-triazine-2,4-diamine (1:1), with CAS number 8067-46-7, is a complex organic compound characterized by its sulfonic acid and triazine functionalities. This substance typically exhibits high solubility in polar solvents due to the presence of sulfonic acid groups, which enhance its ionic character. The triazine moiety contributes to its potential as a dye or pigment, often utilized in various applications including textiles and coatings. The dichlorophenyl group may impart specific electronic properties, influencing the compound's reactivity and stability. Additionally, the presence of multiple functional groups suggests that it may participate in various chemical reactions, making it versatile in synthetic chemistry. Its structural complexity may also lead to interesting interactions in biological systems, although specific biological activity would require further investigation. Overall, this compound represents a unique combination of aromatic and heterocyclic chemistry, with potential applications in materials science and organic synthesis.
Formula:C21H21Cl2N5O6S2
InChI:InChI=1/C11H13Cl2N5.C10H8O6S2/c1-11(2)17-9(14)16-10(15)18(11)6-3-4-7(12)8(13)5-6;11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16/h3-5H,1-2H3,(H4,14,15,16,17);1-6H,(H,11,12,13)(H,14,15,16)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
D54 naponate
CAS:D54 Naponate is a stored salt form of biologically active phenothiazine, which has good antitumor activity and can be maintained longer in the body.
Formula:C21H21Cl2N5O6S2Color and Shape:SolidMolecular weight:574.46
