CymitQuimica logo

CAS 80683-84-7

:

3-pyridinol, 6-amino-2-methyl-

Description:
3-Pyridinol, 6-amino-2-methyl- is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a hydroxyl group (-OH) at the 3-position, an amino group (-NH2) at the 6-position, and a methyl group (-CH3) at the 2-position of the pyridine ring. These functional groups contribute to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the amino group can enhance its basicity and ability to form hydrogen bonds, while the hydroxyl group may influence its solubility in polar solvents. The compound's molecular structure suggests it may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Additionally, its unique arrangement of substituents can lead to specific biological activities, making it of interest in medicinal chemistry. As with many nitrogen-containing heterocycles, it may exhibit diverse properties, including antimicrobial or anti-inflammatory effects, depending on its specific interactions within biological systems.
Formula:C6H8N2O
InChI:InChI=1/C6H8N2O/c1-4-5(9)2-3-6(7)8-4/h2-3,9H,1H3,(H2,7,8)
InChI key:GCMAADAQDHYREX-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=N1)N)O
Synonyms:
  • 6-Amino-2-methylpyridin-3-ol
Found 4 products.