CymitQuimica logo

CAS 80685-20-7

:

2-(2-fluoro-4'-hydroxybiphenyl-4-yl)propanoic acid

Description:
2-(2-Fluoro-4'-hydroxybiphenyl-4-yl)propanoic acid, with the CAS number 80685-20-7, is a chemical compound that belongs to the class of aromatic carboxylic acids. This substance features a biphenyl structure substituted with a fluorine atom and a hydroxyl group, contributing to its unique chemical properties. The presence of the propanoic acid moiety indicates that it has a carboxylic acid functional group, which can participate in various chemical reactions, such as esterification and acid-base reactions. The fluorine atom can enhance the compound's lipophilicity and influence its biological activity, making it of interest in pharmaceutical research. Additionally, the hydroxyl group can engage in hydrogen bonding, affecting the compound's solubility and reactivity. Overall, this compound's structural characteristics suggest potential applications in medicinal chemistry and materials science, although specific biological activities and applications would require further investigation.
Formula:C15H13FO3
InChI:InChI=1/C15H13FO3/c1-9(15(18)19)11-4-7-13(14(16)8-11)10-2-5-12(17)6-3-10/h2-9,17H,1H3,(H,18,19)
Synonyms:
  • [1,1'-biphenyl]-4-acetic acid, 2-fluoro-4'-hydroxy-alpha-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.