
CAS 80689-21-0
:6,7-Dimethyl-2(3H)-benzothiazolone
Description:
6,7-Dimethyl-2(3H)-benzothiazolone, with the CAS number 80689-21-0, is an organic compound characterized by its benzothiazole structure, which consists of a fused benzene and thiazole ring. This compound typically exhibits a yellow to orange color and is known for its potential applications in various fields, including as a dye or pigment. It possesses a heterocyclic structure that contributes to its chemical reactivity and stability. The presence of methyl groups at the 6 and 7 positions enhances its lipophilicity, which can influence its solubility in organic solvents. Additionally, benzothiazolone derivatives are often recognized for their biological activity, including antimicrobial and antifungal properties. The compound's stability under various conditions makes it suitable for use in formulations, although specific handling and safety measures should be observed due to potential toxicity. Overall, 6,7-Dimethyl-2(3H)-benzothiazolone is a versatile compound with significant relevance in both industrial and research applications.
Formula:C9H9NOS
InChI:InChI=1S/C9H9NOS/c1-5-3-4-7-8(6(5)2)12-9(11)10-7/h3-4H,1-2H3,(H,10,11)
InChI key:InChIKey=OTLGEWGTPFUDCJ-UHFFFAOYSA-N
SMILES:CC1=C2C(NC(=O)S2)=CC=C1C
Synonyms:- 2(3H)-Benzothiazolone, 6,7-dimethyl-
- 6,7-Dimethyl-2(3H)-benzothiazolone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.