
CAS 807-31-8
:N-[[1-[4-(4-Fluorophenyl)-4-oxobutyl]-4-phenyl-4-piperidinyl]methyl]acetamide
Description:
N-[[1-[4-(4-Fluorophenyl)-4-oxobutyl]-4-phenyl-4-piperidinyl]methyl]acetamide, with CAS number 807-31-8, is a chemical compound characterized by its complex structure, which includes a piperidine ring and an acetamide functional group. This substance typically exhibits properties associated with its molecular structure, such as potential lipophilicity due to the presence of aromatic rings and a fluorine atom, which can influence its biological activity and pharmacokinetics. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as it could interact with various biological targets. Its synthesis involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its identity and purity. Safety data sheets would provide information on handling, storage, and potential hazards associated with this compound, emphasizing the importance of proper laboratory practices when working with chemical substances.
Formula:C24H29FN2O2
InChI:InChI=1S/C24H29FN2O2/c1-19(28)26-18-24(21-6-3-2-4-7-21)13-16-27(17-14-24)15-5-8-23(29)20-9-11-22(25)12-10-20/h2-4,6-7,9-12H,5,8,13-18H2,1H3,(H,26,28)
InChI key:InChIKey=VDGZERMDPAAZEJ-UHFFFAOYSA-N
SMILES:C(NC(C)=O)C1(CCN(CCCC(=O)C2=CC=C(F)C=C2)CC1)C3=CC=CC=C3
Synonyms:- Acetamide, N-[[1-[3-(p-fluorobenzoyl)propyl]-4-phenyl-4-piperidyl]methyl]-
- Aceperone
- 4-[4-(Acetamidomethyl)-4-phenylpiperidino]-4′-fluorobutyrophenone
- N-[[1-[4-(4-Fluorophenyl)-4-oxobutyl]-4-phenyl-4-piperidinyl]methyl]acetamide
- Acetamide, N-[[1-[4-(4-fluorophenyl)-4-oxobutyl]-4-phenyl-4-piperidinyl]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acetabuton
CAS:Acetabuton is an alpha-adrenergic blocker and a hemodynamic and sympathetic drug.Formula:C24H29FN2O2Color and Shape:SolidMolecular weight:396.5
