CAS 80705-15-3
:1-Hexanol, 3,3,4,4,5,5,6,6,6-nonafluoro-, 1-acetate
Description:
1-Hexanol, 3,3,4,4,5,5,6,6,6-nonafluoro-, 1-acetate, with CAS number 80705-15-3, is a fluorinated alcohol derivative characterized by the presence of a hexanol backbone and multiple fluorine atoms attached to the carbon chain. This compound typically exhibits unique properties due to the influence of the fluorine atoms, such as increased hydrophobicity and thermal stability. The acetate functional group contributes to its reactivity and potential applications in various chemical processes. The presence of fluorine can enhance the compound's resistance to degradation and improve its performance in specific applications, such as in surfactants or as intermediates in organic synthesis. Additionally, the molecular structure suggests potential uses in the development of specialty chemicals, coatings, or as a solvent in various industrial applications. However, the environmental and health impacts of fluorinated compounds should be considered, as they can exhibit persistence in the environment and potential bioaccumulation.
Formula:C8H7F9O2
InChI:InChI=1S/C8H7F9O2/c1-4(18)19-3-2-5(9,10)6(11,12)7(13,14)8(15,16)17/h2-3H2,1H3
InChI key:InChIKey=WUXJRZYSKWYAEV-UHFFFAOYSA-N
SMILES:C(C(C(F)(F)F)(F)F)(C(CCOC(C)=O)(F)F)(F)F
Synonyms:- 1-Hexanol, 3,3,4,4,5,5,6,6,6-nonafluoro-, 1-acetate
- 1-Hexanol, 3,3,4,4,5,5,6,6,6-nonafluoro-, acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

