CAS 80708-26-5

2-Chloro-4-methylpyrido[2,3-b]pyrazin-3(4H)-one

Description:

2-Chloro-4-methylpyrido[2,3-b]pyrazin-3(4H)-one is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyrazine rings. This compound features a chlorine atom and a methyl group attached to the pyridine ring, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chloro and methyl substituents can influence its electronic properties, making it of interest in medicinal chemistry and material science. The compound may also display specific pharmacological activities, which can be explored in drug development contexts. Its CAS number, 80708-26-5, allows for easy identification in chemical databases and literature. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, depending on the reaction conditions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₈H₆ClN₃O

InChI: InChI=1S/C8H6ClN3O/c1-12-7-5(3-2-4-10-7)11-6(9)8(12)13/h2-4H,1H3

InChI key: InChIKey=MWCFAYSPSOMQEX-UHFFFAOYSA-N

SMILES: CN1C=2C(N=C(Cl)C1=O)=CC=CN2

Synonyms:

• 2-Chloro-4-methylpyrido[2,3-b]pyrazin-3-one
• 2-Chloro-4-methyl-3H,4H-pyrido[2,3-b]pyrazin-3-one
• 2-Chloro-4-methyl-4H-pyrido[2,3-b]pyrazine-3-one
• 2-Chloro-4-methylpyrido[2,3-b]pyrazin-3(4H)-one
• Pyrido[2,3-b]pyrazin-3(4H)-one, 2-chloro-4-methyl-