CymitQuimica logo

CAS 80714-26-7

:

1-(6-Chloro-2-pyridyl)-1H-3-hydroxy-1,2,4-triazole

Description:
1-(6-Chloro-2-pyridyl)-1H-3-hydroxy-1,2,4-triazole, identified by its CAS number 80714-26-7, is a chemical compound that belongs to the class of triazoles, which are five-membered heterocyclic compounds containing three nitrogen atoms. This substance features a pyridine ring substituted with a chlorine atom, contributing to its unique properties and potential biological activity. The presence of the hydroxyl group (-OH) in the triazole structure enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. This compound is of interest in various fields, including agricultural chemistry, where it may serve as a fungicide or herbicide, and in medicinal chemistry for its potential therapeutic applications. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods and are essential for understanding its behavior in different environments. Safety and handling precautions should be observed due to the presence of chlorine, which can pose health risks.
Formula:C7H5ClN4O
InChI:InChI=1/C7H5ClN4O/c8-5-2-1-3-6(10-5)12-4-9-7(13)11-12/h1-4H,(H,11,13)
SMILES:c1cc(Cl)nc(c1)n1cnc(n1)O
Synonyms:
  • 1H-1,2,4-triazol-3-ol, 1-(6-chloro-2-pyridinyl)-
  • 1-(6-chloropyridin-2-yl)-1,2-dihydro-3H-1,2,4-triazol-3-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.