CAS 80721-13-7

4,4-diethyl-2,6-dioxopiperidine-3,5-dicarbonitrile

Description:

4,4-Diethyl-2,6-dioxopiperidine-3,5-dicarbonitrile, identified by its CAS number 80721-13-7, is a synthetic organic compound characterized by its unique piperidine ring structure. This compound features two ethyl groups attached to the 4-position of the piperidine ring, contributing to its hydrophobic properties. The presence of two carbonyl groups (dioxo) at the 2 and 6 positions enhances its reactivity, making it a potential candidate for various chemical reactions, including condensation and nucleophilic addition. Additionally, the dicarbonitrile functional groups at the 3 and 5 positions introduce significant polarity and potential for hydrogen bonding, which can influence its solubility in polar solvents. The compound's structure suggests it may exhibit interesting biological activities, although specific studies on its pharmacological properties may be limited. Overall, 4,4-diethyl-2,6-dioxopiperidine-3,5-dicarbonitrile is a versatile compound that may find applications in organic synthesis and material science.

Formula: C₁₁H₁₃N₃O₂

InChI: InChI=1/C11H13N3O2/c1-3-11(4-2)7(5-12)9(15)14-10(16)8(11)6-13/h7-8H,3-4H2,1-2H3,(H,14,15,16)

SMILES: CCC1(CC)C(C#N)C(=NC(=O)C1C#N)O

4,4-Diethyl-2,6-dioxopiperidine-3,5-dicarbonitrile

CAS: 80721-13-7

Versatile small molecule scaffold

Formula: C₁₁H₁₃N₃O₂

Purity: Min. 95%

Molecular weight: 219.24 g/mol

Ref: 3D-FDA72113