CAS 80724-19-2
:2-[6-(dimethylamino)-3-(dimethyliminio)-3H-xanthen-9-yl]-5-isothiocyanatobenzoate
Description:
The chemical substance known as "2-[6-(dimethylamino)-3-(dimethyliminio)-3H-xanthen-9-yl]-5-isothiocyanatobenzoate," with the CAS number 80724-19-2, is a synthetic organic compound that belongs to the class of xanthene dyes. It features a complex structure characterized by a xanthene core, which is a polycyclic aromatic compound, and is substituted with a dimethylamino group and a dimethyliminio group, contributing to its chromophoric properties. The presence of an isothiocyanate functional group enhances its reactivity, making it useful in various chemical applications, including as a fluorescent dye or in biological staining. This compound is typically characterized by its vibrant color and fluorescence, which can be influenced by pH and solvent conditions. Its unique properties make it valuable in fields such as biochemistry, materials science, and analytical chemistry. Safety and handling precautions should be observed, as with many synthetic dyes, due to potential toxicity and environmental impact.
Formula:C25H21N3O3S
InChI:InChI=1/C25H21N3O3S/c1-27(2)16-6-9-19-22(12-16)31-23-13-17(28(3)4)7-10-20(23)24(19)18-8-5-15(26-14-32)11-21(18)25(29)30/h5-13H,1-4H3
SMILES:CN(C)c1ccc2c(c1)[o+]c1cc(ccc1c2c1ccc(cc1C(=O)[O-])N=C=S)N(C)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-TRITC
CAS:5-TRITC is an amine-reactive fluorescent dye to label proteins and nucleic acids, red-orange fluorescence with excitation/emission maxima of about 555/580 nm.Formula:C25H21N3O3SPurity:95.4%Color and Shape:SolidMolecular weight:443.52Tetramethylrhodamine-5-isothiocyanate
CAS:Formula:C25H21N3O3SPurity:(HPLC) ≥ 95.0%Color and Shape:Purple powderMolecular weight:443.52Tetramethylrhodamine-5-isothiocyanate
CAS:Tetramethylrhodamine-5-isothiocyanate (TRITC) is a fluorescent dye that can be used for the detection of cancer cells. This molecule interacts with mitochondrial membrane potential and superparamagnetic iron oxide nanoparticles, which are used to detect cancer cells. TRITC is linked to a carrier protein, such as wheat germ agglutinin or streptavidin, and then incubated with the target tissue. The dye is taken up by cells with high mitochondrial membrane potential, which are typically cancerous. The dye can also be detected using an analytical method called flow cytometry, which detects changes in the fluorescence intensity of the dyed cells. TRITC has been shown to have anti-cancer properties in basic fibroblast growth factor-deficient mice and in human colon carcinoma cells in vitro.Formula:C25H21N3O3SPurity:Min. 95%Color and Shape:PowderMolecular weight:443.52 g/molTetramethylrhodamine-5-isothiocyanate
CAS:Controlled ProductFormula:C25H21N3O3SColor and Shape:NeatMolecular weight:443.517





