CAS 80724-19-2

2-[6-(dimethylamino)-3-(dimethyliminio)-3H-xanthen-9-yl]-5-isothiocyanatobenzoate

Description:

The chemical substance known as "2-[6-(dimethylamino)-3-(dimethyliminio)-3H-xanthen-9-yl]-5-isothiocyanatobenzoate," with the CAS number 80724-19-2, is a synthetic organic compound that belongs to the class of xanthene dyes. It features a complex structure characterized by a xanthene core, which is a polycyclic aromatic compound, and is substituted with a dimethylamino group and a dimethyliminio group, contributing to its chromophoric properties. The presence of an isothiocyanate functional group enhances its reactivity, making it useful in various chemical applications, including as a fluorescent dye or in biological staining. This compound is typically characterized by its vibrant color and fluorescence, which can be influenced by pH and solvent conditions. Its unique properties make it valuable in fields such as biochemistry, materials science, and analytical chemistry. Safety and handling precautions should be observed, as with many synthetic dyes, due to potential toxicity and environmental impact.

Formula: C₂₅H₂₁N₃O₃S

InChI: InChI=1/C25H21N3O3S/c1-27(2)16-6-9-19-22(12-16)31-23-13-17(28(3)4)7-10-20(23)24(19)18-8-5-15(26-14-32)11-21(18)25(29)30/h5-13H,1-4H3

SMILES: CN(C)c1ccc2c(c1)[o+]c1cc(ccc1c2c1ccc(cc1C(=O)[O-])N=C=S)N(C)C

5-TRITC

CAS: 80724-19-2

Formula: C₂₅H₂₁N₃O₃S

Purity: 90%

Molecular weight: 443.5175

Ref: IN-DA00G5OH

5-TRITC

CAS: 80724-19-2

5-TRITC

Purity: ≥95%

Molecular weight: 443.52g/mol

Ref: 54-BUP21704

5-TRITC

CAS: 80724-19-2

5-TRITC is an amine-reactive fluorescent dye to label proteins and nucleic acids, red-orange fluorescence with excitation/emission maxima of about 555/580 nm.

Formula: C₂₅H₂₁N₃O₃S

Purity: 95.4%

Color and Shape: Solid

Molecular weight: 443.52

Ref: TM-TD0057

Tetramethylrhodamine-5-isothiocyanate

CAS: 80724-19-2

Formula: C₂₅H₂₁N₃O₃S

Purity: (HPLC) ≥ 95.0%

Color and Shape: Purple powder

Molecular weight: 443.52

Ref: 7W-GT6005

Tetramethylrhodamine-5-isothiocyanate

CAS: 80724-19-2

Tetramethylrhodamine-5-isothiocyanate (TRITC) is a fluorescent dye that can be used for the detection of cancer cells. This molecule interacts with mitochondrial membrane potential and superparamagnetic iron oxide nanoparticles, which are used to detect cancer cells. TRITC is linked to a carrier protein, such as wheat germ agglutinin or streptavidin, and then incubated with the target tissue. The dye is taken up by cells with high mitochondrial membrane potential, which are typically cancerous. The dye can also be detected using an analytical method called flow cytometry, which detects changes in the fluorescence intensity of the dyed cells.
TRITC has been shown to have anti-cancer properties in basic fibroblast growth factor-deficient mice and in human colon carcinoma cells in vitro.

Formula: C₂₅H₂₁N₃O₃S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 443.52 g/mol

Ref: 3D-FT146888

Tetramethylrhodamine-5-isothiocyanate

Controlled Product

CAS: 80724-19-2

Formula: C₂₅H₂₁N₃O₃S

Color and Shape: Neat

Molecular weight: 443.517

Ref: TR-T305733