CAS 807315-42-0

1-(2-Phenylethyl)-4-piperidinecarboxylic acid

Description:

1-(2-Phenylethyl)-4-piperidinecarboxylic acid, identified by its CAS number 807315-42-0, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a phenylethyl group attached to the nitrogen atom of the piperidine, along with a carboxylic acid functional group at the fourth position of the piperidine ring. The presence of the carboxylic acid group imparts acidic properties, making it capable of participating in various chemical reactions, such as esterification and amidation. The phenylethyl moiety contributes to the compound's potential biological activity, as similar structures are often found in pharmacologically active compounds. Additionally, the compound's solubility and stability can be influenced by the pH of the environment, as well as the presence of other functional groups. Overall, 1-(2-Phenylethyl)-4-piperidinecarboxylic acid is of interest in medicinal chemistry and may have applications in drug development or as a biochemical probe.

Formula: C₁₄H₁₉NO₂

InChI: InChI=1S/C14H19NO2/c16-14(17)13-7-10-15(11-8-13)9-6-12-4-2-1-3-5-12/h1-5,13H,6-11H2,(H,16,17)

InChI key: InChIKey=YJZWAIODVQBJME-UHFFFAOYSA-N

SMILES: C(CC1=CC=CC=C1)N2CCC(C(O)=O)CC2

Synonyms:

• 1-(2-Phenylethyl)-4-piperidinecarboxylic acid
• 4-Piperidinecarboxylic acid, 1-(2-phenylethyl)-
• 1-(2-Phenylethyl)piperidin-1-ium-4-carboxylate