CymitQuimica logo

CAS 80772-97-0

:

6-Nitropyrazolo[1,5-a]pyrimidine-3-carbonitrile

Description:
6-Nitropyrazolo[1,5-a]pyrimidine-3-carbonitrile is a heterocyclic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both nitro and cyano functional groups. This compound typically exhibits a pale yellow to light brown crystalline appearance. The presence of the nitro group contributes to its potential reactivity and may influence its electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The cyano group enhances its ability to participate in nucleophilic reactions, further expanding its utility in synthetic chemistry. Additionally, the compound may exhibit biological activity, which can be explored for potential therapeutic applications. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, 6-Nitropyrazolo[1,5-a]pyrimidine-3-carbonitrile is a compound of interest due to its structural features and potential reactivity, making it a subject of study in both organic synthesis and medicinal chemistry.
Formula:C7H3N5O2
InChI:InChI=1S/C7H3N5O2/c8-1-5-2-10-11-4-6(12(13)14)3-9-7(5)11/h2-4H
InChI key:InChIKey=VNLCZQRGTFVAQI-UHFFFAOYSA-N
SMILES:C(#N)C1=C2N(C=C(N(=O)=O)C=N2)N=C1
Synonyms:
  • 6-Nitropyrazolo[1,5-a]pyrimidine-3-carbonitrile
  • Pyrazolo[1,5-a]pyrimidine-3-carbonitrile, 6-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.