CymitQuimica logo

CAS 80809-42-3

:

3-(2-Thienyl)-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-amine

Description:
3-(2-Thienyl)-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-amine is a heterocyclic compound characterized by its complex structure, which includes a triazole and thiadiazole moiety fused together. This compound features a thienyl group, which contributes to its aromatic properties and potential electronic characteristics. The presence of nitrogen and sulfur atoms in its structure suggests that it may exhibit interesting chemical reactivity and biological activity. Typically, such compounds can be investigated for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The molecular framework may allow for various interactions, including hydrogen bonding and π-π stacking, which can influence its solubility and stability. Additionally, the compound's unique structure may impart specific properties such as fluorescence or conductivity, making it a candidate for further research in material science or medicinal chemistry. Overall, 3-(2-Thienyl)-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-amine represents a fascinating subject for study due to its diverse potential applications.
Formula:C7H5N5S2
InChI:InChI=1S/C7H5N5S2/c8-6-11-12-5(4-2-1-3-13-4)9-10-7(12)14-6/h1-3H,(H2,8,11)
InChI key:InChIKey=XEMVVTSATQCRRK-UHFFFAOYSA-N
SMILES:NC1=NN2C(=NN=C2S1)C3=CC=CS3
Synonyms:
  • 3-Thiophen-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine
  • 3-(2-Thienyl)-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-amine
  • 1,2,4-Triazolo[3,4-b][1,3,4]thiadiazol-6-amine, 3-(2-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.