CAS 808126-65-0

oxazol-5-ylboronic acid

Description:

Oxazol-5-ylboronic acid is an organic compound characterized by the presence of both an oxazole ring and a boronic acid functional group. The oxazole ring, a five-membered heterocyclic structure containing nitrogen and oxygen, contributes to the compound's unique reactivity and potential applications in medicinal chemistry. The boronic acid moiety is known for its ability to form reversible covalent bonds with diols, making it valuable in various chemical reactions, including Suzuki coupling, which is widely used in organic synthesis. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the boronic acid group. Its reactivity and functional versatility make it a useful intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, oxazol-5-ylboronic acid may exhibit biological activity, making it a subject of interest in drug discovery and development. As with many boronic acids, care should be taken in handling due to potential reactivity with moisture and air.

Formula: C₃H₄BNO₃

InChI: InChI=1/C3H4BNO3/c6-4(7)3-1-5-2-8-3/h1-2,6-7H

SMILES: c1c(B(O)O)ocn1

Synonyms:

• 1,3-Oxazol-5-Ylboronic Acid
• Boronic acid, B-5-oxazolyl-

1,3-Oxazol-5-ylboronic acid

CAS: 808126-65-0

Formula: C₃H₄BNO₃

Molecular weight: 112.8798

Ref: IN-DA005IPI

Oxazol-5-ylboronic Acid

Controlled Product

CAS: 808126-65-0

Applications Oxazol-5-ylboronic Acid is a reactant used in the synthesis of 7-aminofuro[2,3-c]pyridine as an inhibitor of TAK1, a protein kinase.
References Hornberger, K.R., et al.: Bioorg. Med. Chem. Lett., 23, 4517-4522 (2013)

Formula: C₃H₄BNO₃

Color and Shape: Neat

Molecular weight: 112.88

Ref: TR-O858585