
CAS 80813-42-9
:(3-Chloro-2,2-dimethylpropoxy)trimethylsilane
Description:
(3-Chloro-2,2-dimethylpropoxy)trimethylsilane, with the CAS number 80813-42-9, is an organosilicon compound characterized by the presence of a trimethylsilyl group and a chloroalkoxy functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of the chlorine atom, which can participate in nucleophilic substitution reactions. The trimethylsilyl group enhances the compound's stability and solubility in organic solvents, making it useful in various chemical applications, including as a coupling agent or a precursor in the synthesis of silane-based materials. Its structure suggests that it may also exhibit properties such as hydrophobicity and potential compatibility with organic substrates. Safety considerations should be taken into account when handling this compound, as it may pose risks associated with its chlorinated nature and potential reactivity. Overall, (3-Chloro-2,2-dimethylpropoxy)trimethylsilane is a versatile compound in the field of organosilicon chemistry.
Formula:C8H19ClOSi
InChI:InChI=1S/C8H19ClOSi/c1-8(2,6-9)7-10-11(3,4)5/h6-7H2,1-5H3
InChI key:InChIKey=DVCGIEWNXHQSFK-UHFFFAOYSA-N
SMILES:C(CO[Si](C)(C)C)(CCl)(C)C
Synonyms:- 1-Chloro-2,2-dimethyl-3-(trimethylsiloxy)propane
- Silane, (3-chloro-2,2-dimethylpropoxy)trimethyl-
- (3-Chloro-2,2-dimethylpropoxy)trimethylsilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.