CAS 808134-01-2

5-Bromo-2-methoxy-4-methylbenzenesulfonamide

Description:

5-Bromo-2-methoxy-4-methylbenzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a bromine atom and a methoxy group attached to a benzene ring, along with a methyl group, contributing to its unique chemical properties. The presence of the sulfonamide group enhances its solubility in polar solvents and may influence its biological activity. The bromine substituent can affect the compound's reactivity and stability, while the methoxy group can enhance lipophilicity, potentially impacting its pharmacokinetic profile. This compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the design of new therapeutic agents. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile building block in organic synthesis. Overall, 5-Bromo-2-methoxy-4-methylbenzenesulfonamide exemplifies the complexity and utility of sulfonamide derivatives in chemical research.

Formula: C₈H₁₀BrNO₃S

InChI: InChI=1S/C8H10BrNO3S/c1-5-3-7(13-2)8(4-6(5)9)14(10,11)12/h3-4H,1-2H3,(H2,10,11,12)

InChI key: InChIKey=PCMGOJLPHXXIIO-UHFFFAOYSA-N

SMILES: O(C)C1=C(S(N)(=O)=O)C=C(Br)C(C)=C1

Synonyms:

• Benzenesulfonamide, 5-bromo-2-methoxy-4-methyl-
• 5-Bromo-2-methoxy-4-methylbenzenesulfonamide