CymitQuimica logo

CAS 808137-94-2

:

methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate

Description:
Methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures. This compound features a carboxylate ester functional group, which contributes to its reactivity and solubility properties. It typically appears as a solid or liquid depending on the specific conditions and can be soluble in organic solvents. The presence of the methyl ester group enhances its potential for further chemical modifications, making it a valuable intermediate in organic synthesis. Its unique bicyclic structure may impart specific biological activities, making it of interest in medicinal chemistry and drug development. The compound's CAS number, 808137-94-2, allows for easy identification and retrieval of information in chemical databases. Overall, methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate is notable for its structural complexity and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H8N2O2
InChI:InChI=1/C9H8N2O2/c1-13-9(12)7-5-11-8-6(7)3-2-4-10-8/h2-5H,1H3,(H,10,11)
InChI key:XYRUNIAHPKBUJT-UHFFFAOYSA-N
SMILES:COC(=O)c1c[nH]c2c1cccn2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, methyl ester
  • Methyl-1H-pyrrolo[2,3-b]pyridin-3-carboxylat
Found 3 products.