CymitQuimica logo

CAS 80816-54-2

:

3-Hydroxy-2-oxepanone

Description:
3-Hydroxy-2-oxepanone, also known by its CAS number 80816-54-2, is a cyclic ester that features a six-membered ring structure containing both a hydroxyl group and a carbonyl group. This compound is characterized by its lactone formation, which is a result of the reaction between a hydroxy acid and itself or another molecule, leading to a stable cyclic structure. The presence of the hydroxyl group contributes to its potential reactivity, making it a candidate for various chemical transformations. 3-Hydroxy-2-oxepanone is typically colorless to pale yellow in appearance and may exhibit moderate solubility in polar solvents due to its functional groups. Its applications can span across fields such as organic synthesis, pharmaceuticals, and materials science, where it may serve as an intermediate or a building block for more complex molecules. As with many organic compounds, handling should be done with care, considering potential health and safety implications.
Formula:C6H10O3
InChI:InChI=1S/C6H10O3/c7-5-3-1-2-4-9-6(5)8/h5,7H,1-4H2
InChI key:InChIKey=HUFRMAUWIZDZIJ-UHFFFAOYSA-N
SMILES:OC1C(=O)OCCCC1
Synonyms:
  • 3-Hydroxy-2-oxepanone
  • 2-Oxepanone, 3-hydroxy-
  • α-Hydroxycaprolactone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.