CAS 80828-32-6
:(2S,3aS,7aS)-1-[(2S)-2-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}propanoyl]octahydro-1H-indole-2-carboxylic acid hydrochloride (1:1) (non-preferred name)
Description:
The chemical substance with the name "(2S,3aS,7aS)-1-[(2S)-2-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}propanoyl]octahydro-1H-indole-2-carboxylic acid hydrochloride" and CAS number 80828-32-6 is a complex organic compound characterized by its multi-cyclic structure and specific stereochemistry. It features an octahydroindole core, which is a bicyclic structure that contributes to its biological activity. The presence of an ethoxy group and a phenylbutanoyl moiety indicates potential interactions with biological targets, making it of interest in pharmaceutical research. The hydrochloride salt form suggests enhanced solubility and stability, which are advantageous for drug formulation. This compound may exhibit specific pharmacological properties, potentially acting as an agonist or antagonist in various biological pathways. Its stereochemical configuration is crucial for its activity, as the arrangement of substituents can significantly influence its interaction with biological receptors. Overall, this compound represents a class of molecules that may have therapeutic applications, particularly in the fields of medicinal chemistry and drug development.
Formula:C24H35ClN2O5
InChI:InChI=1/C24H34N2O5.ClH/c1-3-31-24(30)19(14-13-17-9-5-4-6-10-17)25-16(2)22(27)26-20-12-8-7-11-18(20)15-21(26)23(28)29;/h4-6,9-10,16,18-21,25H,3,7-8,11-15H2,1-2H3,(H,28,29);1H/t16-,18-,19-,20-,21-;/m0./s1
SMILES:CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N1[C@H]2CCCC[C@H]2C[C@H]1C(=O)O.Cl
Synonyms:- (2S-(1(R*(R*)),2a,3ab,7ab))-Octahydro-1-(2-((1-(ethoxycarbonyl)-3-phenylpropyl)amino)-1-oxopropyl)-1H-indole-2-carboxylic Acid Monohydrochloride
- (2S,3aS,7aS)-1-(N-((1S)-1-((Ethyloxy)carbonyl)-3-phenylpropyl)-L-alanyl)octahydro-1H-indole-2-carboxylic Acid Hydrochloride
- Sch 31846 hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
S,S,S,S,S-Trandolapril Hydrochloride
CAS:Controlled ProductFormula:C24H34N2O5·ClHColor and Shape:NeatMolecular weight:466.998Indolapril hydrochloride
CAS:Indolapril hydrochloride is a nonsulfhydryl angiotensin converting enzyme (ACE) inhibitor with antihypertensive activity.Formula:C24H35ClN2O5Color and Shape:SolidMolecular weight:467

