CAS 80832-54-8

2-(3,4-dimethylphenyl)-2-oxo-1-phenylethyl 3-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-isoindol-2-yl)benzoate

Description:

The chemical substance known as "2-(3,4-dimethylphenyl)-2-oxo-1-phenylethyl 3-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-isoindol-2-yl)benzoate," with the CAS number 80832-54-8, is a complex organic compound characterized by its multi-functional structure. It features a phenyl group and a dioxo-isoindole moiety, indicating potential biological activity. The presence of the dimethylphenyl group suggests that it may exhibit hydrophobic properties, while the dioxo and ester functionalities could contribute to its reactivity and solubility in various solvents. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, possibly acting as a lead compound for drug development. Its synthesis and characterization would typically involve advanced organic synthesis techniques, and its stability, solubility, and reactivity would be crucial for understanding its applications. Further studies would be necessary to elucidate its specific properties, biological activities, and potential uses in pharmaceuticals or other fields.

Formula: C₃₁H₂₇NO₅

InChI: InChI=1/C31H27NO5/c1-19-15-16-22(17-20(19)2)27(33)28(21-9-4-3-5-10-21)37-31(36)23-11-8-12-24(18-23)32-29(34)25-13-6-7-14-26(25)30(32)35/h3-12,15-18,25-26,28H,13-14H2,1-2H3

SMILES: Cc1ccc(cc1C)C(=O)C(c1ccccc1)OC(=O)c1cccc(c1)N1C(=O)C2CC=CCC2C1=O

Benzaldehyde,5-ethoxy-2-hydroxy-

CAS: 80832-54-8

Formula: C₉H₁₀O₃

Purity: 95%

Molecular weight: 166.1739

Ref: IN-DA0057WX

5-Ethoxy-2-hydroxy-benzaldehyde

CAS: 80832-54-8

Formula: C₉H₁₀O₃

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 166.176

Ref: 10-F057630

5-Ethoxy-2-hydroxy-benzaldehyde

CAS: 80832-54-8

The chemical compound 5-Ethoxy-2-hydroxybenzaldehyde is an aldehyde that has been synthesized by reacting sodium carbonate with 2,5-dichloro-4-ethoxybenzaldehyde. This reaction creates a sodium salt of the aldehyde and leaves behind the desired product in its pure form. It is soluble in water and ethanol. The chemical structure of this compound consists of a benzene ring with two hydroxyl groups on the opposite side of the ring from each other.

Formula: C₉H₁₀O₃

Purity: Min. 95%

Molecular weight: 166.2 g/mol

Ref: 3D-FDA83254