CAS 80836-96-0
:1-(2,3-xylyl)piperazine monohydrochloride
Description:
1-(2,3-Xylyl)piperazine monohydrochloride is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a xylyl group, specifically a 2,3-dimethylphenyl substituent, which contributes to its unique properties. As a monohydrochloride salt, it is typically encountered in a solid form, often as a white to off-white crystalline powder. The presence of the hydrochloride indicates that it is a protonated form, enhancing its solubility in water and making it suitable for various applications in pharmaceuticals and research. The compound may exhibit biological activity, potentially interacting with neurotransmitter systems, which is of interest in medicinal chemistry. Its molecular structure allows for various functional modifications, making it a versatile building block in drug development. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H19ClN2
InChI:InChI=1/C12H18N2.ClH/c1-10-4-3-5-12(11(10)2)14-8-6-13-7-9-14;/h3-5,13H,6-9H2,1-2H3;1H
SMILES:Cc1cccc(c1C)N1CCNCC1.Cl
Synonyms:- 1-/2,3-Dimethylphenyl)-piperazine
- Timtec-Bb Sbb000676
- 1-(2,3-Dimethylphenyl)Piperazine Hydrochloride
- 1-(2,3-Dimethylphenyl)-Piperazine Monohydrochloride
- Labotest-Bb Lt00138170
- 1-(2,3-Dimethylphenyl)piperazineHCl
- 1-(2,3-Dimethylphenyl)-piperaz
- 1-(2,3-Dimethylphenyl)Piperazine Hcl
- 1-(2,3-Dimethylphenyl)Piperazine Hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-(2,3-Dimethylphenyl)-piperazine monohydrochloride
CAS:Controlled ProductPiperazine monohydrochloride is a white crystalline powder that is soluble in water and ethanol. It has a molecular weight of 208.23 and a melting point of 117-119°C. Piperazine monohydrochloride exhibits anti-inflammatory properties, which may be due to its inhibition of prostaglandin synthesis.
Purity:Min. 95%
