CymitQuimica logo

CAS 80840-08-0

:

4-quinoxalin-2-ylbutane-1,2-diol

Description:
4-Quinoxalin-2-ylbutane-1,2-diol is a chemical compound characterized by its unique structure, which includes a quinoxaline moiety and a butane-1,2-diol functional group. This compound typically exhibits properties associated with both heterocyclic compounds and alcohols, such as potential solubility in polar solvents due to the presence of hydroxyl groups. The quinoxaline ring contributes to its aromatic character, which may influence its reactivity and interactions with biological systems. Compounds like this can be of interest in medicinal chemistry, particularly for their potential pharmacological activities, including antimicrobial or anticancer properties. The presence of the butane-1,2-diol segment may also suggest potential for hydrogen bonding and interactions with other biomolecules. As with many organic compounds, the specific physical and chemical properties, such as melting point, boiling point, and spectral characteristics, would need to be determined experimentally or sourced from reliable databases for precise applications in research or industry.
Formula:C12H14N2O2
InChI:InChI=1/C12H14N2O2/c15-8-10(16)6-5-9-7-13-11-3-1-2-4-12(11)14-9/h1-4,7,10,15-16H,5-6,8H2
SMILES:c1ccc2c(c1)ncc(CCC(CO)O)n2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.