CAS 80840-09-1
:1-(2-Quinoxalinyl)-1,2,3,4-butanetetrol
Description:
1-(2-Quinoxalinyl)-1,2,3,4-butanetetrol, with the CAS number 80840-09-1, is a chemical compound characterized by its unique structure that includes a quinoxaline moiety and a butanetetrol framework. This compound typically exhibits properties associated with both its quinoxaline and alcohol functionalities, which may include moderate solubility in polar solvents due to the presence of hydroxyl groups. The quinoxaline ring contributes to potential biological activity, as many quinoxaline derivatives are known for their pharmacological properties, including antimicrobial and anticancer activities. The presence of multiple hydroxyl groups in the butanetetrol structure suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the compound may exhibit chirality, leading to the existence of stereoisomers, which can have different biological activities. Overall, 1-(2-Quinoxalinyl)-1,2,3,4-butanetetrol is of interest in medicinal chemistry and may serve as a scaffold for the development of new therapeutic agents.
Formula:C12H14N2O4
InChI:InChI=1S/C12H14N2O4/c15-6-10(16)12(18)11(17)9-5-13-7-3-1-2-4-8(7)14-9/h1-5,10-12,15-18H,6H2
InChI key:InChIKey=JNOHSLKLTQNYAD-UHFFFAOYSA-N
SMILES:C(C(C(CO)O)O)(O)C1=NC2=C(N=C1)C=CC=C2
Synonyms:- 1,2,3,4-Butanetetrol, 1-(2-quinoxalinyl)-
- 1-(2-Quinoxalinyl)-1,2,3,4-butanetetrol
- NSC 90835
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(Quinoxalin-2-yl)butane-1,2,3,4-tetraol
CAS:Formula:C12H14N2O4Purity:95%Color and Shape:SolidMolecular weight:250.25061-(Quinoxalin-2-yl)butane-1,2,3,4-tetrol
CAS:1-(Quinoxalin-2-yl)butane-1,2,3,4-tetrolPurity:95%Color and Shape:Beige SolidMolecular weight:250.25g/mol1-(2-Quinoxalinyl)-1,2,3,4-butanetetrol
CAS:1-(2-Quinoxalinyl)-1,2,3,4-butanetetrol is a quinoxaline derivative and endogenous metabolite applicable to biochemical experiments and drug synthesis research.Formula:C12H14N2O4Purity:99.49%Color and Shape:SolidMolecular weight:250.252-(1',2',3',4'-Tetrahydroxybutyl)quinoxaline
CAS:2-(1',2',3',4'-Tetrahydroxybutyl)quinoxaline is a chemical compound that is used as a versatile building block in the synthesis of complex compounds. It has been shown to be useful in reactions involving nucleophilic substitution, electrophilic addition, and oxidation. This compound has been used as a reagent for the synthesis of other fine chemicals and as an intermediate for research chemicals and speciality chemicals. 2-(1',2',3',4'-Tetrahydroxybutyl)quinoxaline has CAS No. 80840-09-1 and is soluble in organic solvents. The purity of this product is high, with less than 1% impurities.Formula:C12H14N2O4Purity:Min. 95%Color and Shape:Off-White To Light Brown SolidMolecular weight:250.25 g/mol




