CAS 80854-59-7
:(2Z)-3-(4-nitrophenyl)but-2-enoic acid
Description:
(2Z)-3-(4-nitrophenyl)but-2-enoic acid, also known as 4-nitrophenyl 2-butenoate, is an organic compound characterized by its conjugated double bond system and the presence of a nitro group on a phenyl ring. This compound features a butenoic acid backbone, which contributes to its reactivity and potential applications in organic synthesis. The nitro group, being a strong electron-withdrawing substituent, enhances the acidity of the carboxylic acid functional group, making it more reactive in various chemical reactions. The geometric configuration indicated by the "(2Z)" notation suggests that the substituents around the double bond are oriented on the same side, which can influence the compound's physical properties, such as solubility and melting point. This compound may be utilized in the synthesis of more complex organic molecules and could serve as an intermediate in pharmaceutical or agrochemical applications. Its unique structure and functional groups make it a subject of interest in both academic research and industrial chemistry.
Formula:C10H9NO4
InChI:InChI=1/C10H9NO4/c1-7(6-10(12)13)8-2-4-9(5-3-8)11(14)15/h2-6H,1H3,(H,12,13)/b7-6-
SMILES:C/C(=C/C(=O)O)/c1ccc(cc1)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.