
CAS 80864-07-9
:2,2,5,5-Tetramethylcyclopentanamine
Description:
2,2,5,5-Tetramethylcyclopentanamine, with the CAS number 80864-07-9, is an organic compound characterized by its cyclic structure and amine functional group. It features a cyclopentane ring that is heavily substituted with four methyl groups at the 2 and 5 positions, contributing to its steric bulk and potentially influencing its reactivity and physical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in organic solvents and may exhibit basic properties due to the presence of the amine group. The steric hindrance from the methyl groups can affect its ability to participate in certain chemical reactions, making it a subject of interest in organic synthesis and materials science. Additionally, its unique structure may impart specific characteristics such as increased stability or altered boiling and melting points compared to less substituted amines. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H19N
InChI:InChI=1S/C9H19N/c1-8(2)5-6-9(3,4)7(8)10/h7H,5-6,10H2,1-4H3
InChI key:InChIKey=NASSFFNUSVZSCX-UHFFFAOYSA-N
SMILES:NC1C(C)(C)CCC1(C)C
Synonyms:- 2,2,5,5-Tetramethylcyclopentan-1-amine
- 2,2,5,5-Tetramethylcyclopentanamine
- (2,2,5,5-Tetramethylcyclopentyl)amine
- Cyclopentanamine, 2,2,5,5-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.