CAS 80866-77-9
:1-Chloro-2-methoxy-3-nitrobenzene
Description:
1-Chloro-2-methoxy-3-nitrobenzene, with the CAS number 80866-77-9, is an organic compound that belongs to the class of nitro-substituted aromatic compounds. It features a benzene ring substituted with three functional groups: a chlorine atom, a methoxy group (-OCH3), and a nitro group (-NO2). This compound is characterized by its moderate polarity due to the presence of the electronegative chlorine and nitro groups, which can influence its reactivity and solubility in various solvents. The methoxy group contributes to its electron-donating properties, while the nitro group is a strong electron-withdrawing group, affecting the compound's overall electronic distribution. 1-Chloro-2-methoxy-3-nitrobenzene is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. Its physical properties, such as boiling point and melting point, can vary based on purity and environmental conditions, but it is generally stable under standard conditions. Safety precautions should be taken when handling this compound due to its potential toxicity and environmental impact.
Formula:C7H6ClNO3
InChI:InChI=1S/C7H6ClNO3/c1-12-7-5(8)3-2-4-6(7)9(10)11/h2-4H,1H3
InChI key:InChIKey=MSBUQNLLSANFDL-UHFFFAOYSA-N
SMILES:O(C)C1=C(N(=O)=O)C=CC=C1Cl
Synonyms:- 2-Chloro-6-nitroanisole
- Anisole, 2-chloro-6-nitro-
- Benzene, 1-Chloro-2-Methoxy-3-Nitro-
- 1-Chloro-2-methoxy-3-nitrobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Chloro-6-nitroanisole
CAS:Formula:C7H6ClNO3Purity:97%Color and Shape:SolidMolecular weight:187.58043-Chloro-2-methoxynitrobenzene
CAS:3-Chloro-2-methoxynitrobenzeneFormula:C7H6ClNO3Purity:98%Color and Shape: beige solidMolecular weight:187.58044g/mol2-Chloro-6-nitroanisole
CAS:2-Chloro-6-nitroanisole is a versatile building block that can be used to make a variety of products, including pharmaceuticals, agrochemicals, plastics, and other organic compounds. It can be used as a reagent or research chemical in the synthesis of complex molecules, such as synthetic cannabinoids. 2-Chloro-6-nitroanisole is also useful for making high quality compounds and has been used in the synthesis of a number of pharmaceuticals. This compound is an intermediate that can be used to create scaffolds for drug design.Formula:C7H6ClNO3Purity:Min. 95%Color and Shape:PowderMolecular weight:187.58 g/mol2-Chloro-6-nitroanisole
CAS:Formula:C7H6ClNO3Purity:95%Color and Shape:No data available.Molecular weight:187.58



