
CAS 80866-86-0
:4-(2-Carboxybenzoyl)benzenebutanoic acid
Description:
4-(2-Carboxybenzoyl)benzenebutanoic acid, also known by its CAS number 80866-86-0, is an organic compound characterized by its complex structure, which includes a butanoic acid moiety and two aromatic rings. This compound features a carboxylic acid functional group, contributing to its acidic properties and potential for forming hydrogen bonds. The presence of the two benzene rings enhances its stability and may influence its solubility and reactivity. Typically, compounds like this can exhibit interesting biological activities, making them of interest in pharmaceutical and biochemical research. The molecular structure suggests potential applications in drug design or as intermediates in organic synthesis. Additionally, the compound's ability to participate in various chemical reactions, such as esterification or amidation, can be leveraged in synthetic chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the presence of solvents or other reagents. Overall, 4-(2-Carboxybenzoyl)benzenebutanoic acid represents a versatile compound with potential applications in various fields of chemistry.
Formula:C18H16O5
InChI:InChI=1S/C18H16O5/c19-16(20)7-3-4-12-8-10-13(11-9-12)17(21)14-5-1-2-6-15(14)18(22)23/h1-2,5-6,8-11H,3-4,7H2,(H,19,20)(H,22,23)
InChI key:InChIKey=PBCSZTCIOAKNOF-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C(O)=O)C=CC=C1)C2=CC=C(CCCC(O)=O)C=C2
Synonyms:- 4-(2-Carboxybenzoyl)benzenebutanoic acid
- 2-[[4-(3-Carboxypropyl)phenyl]-oxomethyl]benzoic acid
- Benzenebutanoic acid, 4-(2-carboxybenzoyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
