CAS 80866-94-0
:2-Methyl-3,5-dinitrobenzenemethanol
Description:
2-Methyl-3,5-dinitrobenzenemethanol, with the CAS number 80866-94-0, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with two nitro groups and a hydroxymethyl group. This compound typically appears as a solid at room temperature and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of nitro groups contributes to its reactivity, making it a candidate for further chemical transformations. Additionally, the hydroxymethyl group can participate in hydrogen bonding, influencing its solubility and interaction with other substances. The compound's properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other chemicals. Safety considerations are essential when handling this substance, as nitro compounds can be hazardous and may pose risks of explosion or toxicity. Proper storage and handling protocols should be followed to ensure safety in laboratory or industrial settings.
Formula:C8H8N2O5
InChI:InChI=1S/C8H8N2O5/c1-5-6(4-11)2-7(9(12)13)3-8(5)10(14)15/h2-3,11H,4H2,1H3
InChI key:InChIKey=HLBXFLNVFJFEKD-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C)C(CO)=CC(N(=O)=O)=C1
Synonyms:- 2-Methyl-3,5-dinitrobenzenemethanol
- 2-Methyl-3,5-dinitrobenzyl alcohol
- 3,5-Dinitro-2-methylbenzyl alcohol
- (2-Methyl-3,5-dinitrophenyl)methanol
- Benzenemethanol, 2-methyl-3,5-dinitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
