CymitQuimica logo

CAS 808739-26-6

:

3-(1,3-Benzodioxol-5-yl)-5-isoxazolecarboxaldehyde

Description:
3-(1,3-Benzodioxol-5-yl)-5-isoxazolecarboxaldehyde is a chemical compound characterized by its unique structural features, which include a benzodioxole moiety and an isoxazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and biological activity. The presence of the aldehyde functional group suggests that it can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. Additionally, the benzodioxole structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound is likely to be soluble in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, 3-(1,3-Benzodioxol-5-yl)-5-isoxazolecarboxaldehyde represents a fascinating subject for further research in both synthetic and applied chemistry contexts.
Formula:C11H7NO4
InChI:InChI=1S/C11H7NO4/c13-5-8-4-9(12-16-8)7-1-2-10-11(3-7)15-6-14-10/h1-5H,6H2
InChI key:InChIKey=KHQNHCFTMQNZCA-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(C=2C=C3C(=CC2)OCO3)=NO1
Synonyms:
  • 3-(1,3-Benzodioxol-5-yl)-1,2-oxazole-5-carbaldehyde
  • 3-(1,3-Benzodioxol-5-yl)-5-isoxazolecarboxaldehyde
  • 3-Benzo[1,3]Dioxol-5-Yl-Isoxazole-5-Carbaldehyde
  • 5-Isoxazolecarboxaldehyde, 3-(1,3-benzodioxol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.