CAS 80875-05-4
:3-Amino-2,2,4,4-tetramethylthietane
Description:
3-Amino-2,2,4,4-tetramethylthietane is a sulfur-containing organic compound characterized by its unique thietane ring structure, which incorporates a five-membered ring with a sulfur atom. This compound features four methyl groups and an amino group, contributing to its steric bulk and potential reactivity. The presence of the amino group suggests that it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The bulky tetramethyl substituents may influence its physical properties, such as solubility and boiling point, making it less volatile compared to simpler amines. Additionally, the thietane ring can impart specific conformational characteristics, affecting its interaction with other molecules. This compound may find applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features. However, detailed studies on its toxicity, stability, and reactivity are essential for understanding its practical applications and safety profile.
Formula:C7H15NS
InChI:InChI=1/C7H15NS/c1-6(2)5(8)7(3,4)9-6/h5H,8H2,1-4H3
SMILES:CC1(C)C(C(C)(C)S1)N
Synonyms:- 2,2,4,4-Tetramethyl-3-thietanamine
- 2,2,4,4-Tetramethylthietan-3-Amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-Amino-2,2,4,4-tetramethylthietane
CAS:3-Amino-2,2,4,4-tetramethylthietane is an organic compound that is found in the nitrate group. It is a colorless liquid that is soluble in water and most organic solvents. It can be used as a precursor to other compounds or as a reagent in chemical reactions. 3-Amino-2,2,4,4-tetramethylthietane has been shown to form ethers with sulfate ions and chloride ions. It also catalyzes the activation of vinyl ethers by leuckart's catalyst to produce vinyl sulfonates. 3-Amino-2,2,4,4-tetramethylthietane can be synthesized from thiourea and nitric acid.
Formula:C7H15NSPurity:Min. 95%Color and Shape:White to yellow crystalline powderMolecular weight:145.27 g/molRef: 3D-FA09812
Discontinued product
