CAS 80875-07-6
:(2R)-2-Amino-N-(2,2,4,4-tetramethyl-3-thietanyl)propanamide
Description:
(2R)-2-Amino-N-(2,2,4,4-tetramethyl-3-thietanyl)propanamide, with CAS number 80875-07-6, is a chemical compound characterized by its unique thietanyl group, which contributes to its structural complexity and potential biological activity. This compound features an amino group and an amide functional group, indicating it may participate in hydrogen bonding and exhibit polar characteristics. The presence of the tetramethyl substituents suggests steric hindrance, which can influence its reactivity and interactions with other molecules. The thietanyl ring, a five-membered sulfur-containing heterocycle, may impart specific properties such as increased lipophilicity or altered electronic characteristics. This compound is likely to be of interest in medicinal chemistry and pharmacology due to its potential biological activity, although specific applications and effects would depend on further empirical studies. Overall, its structural features suggest a compound with unique properties that could be explored for various chemical and biological applications.
Formula:C10H20N2OS
InChI:InChI=1S/C10H20N2OS/c1-6(11)7(13)12-8-9(2,3)14-10(8,4)5/h6,8H,11H2,1-5H3,(H,12,13)/t6-/m1/s1
InChI key:InChIKey=VAVRZFPMKSCTDL-ZCFIWIBFSA-N
SMILES:N(C([C@@H](C)N)=O)C1C(C)(C)SC1(C)C
Synonyms:- Propanamide, 2-amino-N-(2,2,4,4-tetramethyl-3-thietanyl)-, (R)-
- Propanamide, 2-amino-N-(2,2,4,4-tetramethyl-3-thietanyl)-, (2R)-
- Thietane, propanamide deriv.
- (2R)-2-Amino-N-(2,2,4,4-tetramethylthietan-3-yl)propanamide
- (2R)-2-Amino-N-(2,2,4,4-tetramethyl-3-thietanyl)propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Alitame - Alanine Amide Impurity (N-(2,2,4,4-tetramethyl-3-thietanyl)-D-alanimamide)
CAS:Nucleic acids and their salts, whether or not chemically defined; other heterocyclic compounds, nesoiFormula:C10H20N2OSColor and Shape:White PowderMolecular weight:216.12963


