CAS 808750-23-4

3-Bromo-4-methoxy-5-methylphenol

Description:

3-Bromo-4-methoxy-5-methylphenol, with the CAS number 808750-23-4, is an organic compound that belongs to the class of phenolic compounds. It features a bromine atom, a methoxy group, and a methyl group attached to a phenolic ring, which contributes to its unique chemical properties. This compound is characterized by its moderate polarity due to the presence of the hydroxyl (-OH) group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The bromine substituent can influence the compound's reactivity, making it useful in various chemical reactions, including electrophilic aromatic substitution. Additionally, the methoxy group can provide electron-donating effects, which may stabilize the aromatic system. 3-Bromo-4-methoxy-5-methylphenol may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis typically involves bromination and methylation reactions, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity. Overall, this compound's unique functional groups and structural characteristics make it a valuable subject of study in organic chemistry.

Formula: C₈H₉BrO₂

InChI: InChI=1S/C8H9BrO2/c1-5-3-6(10)4-7(9)8(5)11-2/h3-4,10H,1-2H3

InChI key: InChIKey=OEOUXIYJVORICL-UHFFFAOYSA-N

SMILES: O(C)C1=C(Br)C=C(O)C=C1C

Synonyms:

• 3-Bromo-4-methoxy-5-methylphenol
• Phenol, 3-bromo-4-methoxy-5-methyl-
• Phenol, 3-bromo-4-methoxy-5-methyl- (9CI)