CAS 808756-85-6
:2,3-Dihydro-5-(1-piperidinyl)-1H-inden-1-one
Description:
2,3-Dihydro-5-(1-piperidinyl)-1H-inden-1-one, identified by its CAS number 808756-85-6, is a chemical compound characterized by its bicyclic structure, which includes an indene core. This compound features a piperidine ring, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the piperidinyl group suggests that it may interact with biological systems, potentially acting as a ligand for various receptors or enzymes. The compound's structure indicates that it may possess properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. Its synthesis and reactivity can be influenced by the functional groups present, making it a candidate for further research in drug discovery and development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, 2,3-Dihydro-5-(1-piperidinyl)-1H-inden-1-one represents a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C14H17NO
InChI:InChI=1S/C14H17NO/c16-14-7-4-11-10-12(5-6-13(11)14)15-8-2-1-3-9-15/h5-6,10H,1-4,7-9H2
InChI key:InChIKey=DBDOOBZPUJXLJY-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(=CC2)N3CCCCC3)CC1
Synonyms:- 2,3-Dihydro-5-(1-piperidinyl)-1H-inden-1-one
- 5-Piperidin-1-ylindan-1-one
- 1H-Inden-1-one, 2,3-dihydro-5-(1-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
