CymitQuimica logo

CAS 808761-43-5

:

3-(aminomethyl)-N-methylbenzenesulfonamide

Description:
3-(Aminomethyl)-N-methylbenzenesulfonamide, identified by its CAS number 808761-43-5, is a sulfonamide compound characterized by the presence of a sulfonamide functional group (-SO2NH2) attached to a benzene ring. This compound features an amino group (-NH2) and a methyl group (-CH3) on the benzene ring, which contribute to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the sulfonamide and amino groups. The sulfonamide moiety is known for its role in medicinal chemistry, particularly in the development of antibacterial agents. The compound may also exhibit properties such as moderate to high melting points and stability under standard conditions, although specific physical properties can vary based on purity and environmental factors. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in the synthesis of biologically active molecules.
Formula:C8H12N2O2S
InChI:InChI=1/C8H12N2O2S/c1-10-13(11,12)8-4-2-3-7(5-8)6-9/h2-5,10H,6,9H2,1H3
SMILES:CNS(=O)(=O)c1cccc(c1)CN
Synonyms:
  • benzenesulfonamide, 3-(aminomethyl)-N-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.