CymitQuimica logo

CAS 808769-15-5

:

N-[2-(3-Bromophenyl)-1,1-dimethylethyl]-2-chloroacetamide

Description:
N-[2-(3-Bromophenyl)-1,1-dimethylethyl]-2-chloroacetamide is a chemical compound characterized by its unique structure, which includes a chloroacetamide functional group and a bromophenyl moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential reactivity due to the presence of the chloro group. The bromophenyl substituent may impart specific electronic and steric effects, influencing its reactivity and interactions with biological targets. The presence of the bulky 1,1-dimethylethyl group can enhance lipophilicity, potentially affecting its pharmacokinetic properties. As a compound with a bromine atom, it may also exhibit unique spectroscopic characteristics, such as distinct NMR and IR signals. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing molecules with specific biological activities or therapeutic applications. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C12H15BrClNO
InChI:InChI=1S/C12H15BrClNO/c1-12(2,15-11(16)8-14)7-9-4-3-5-10(13)6-9/h3-6H,7-8H2,1-2H3,(H,15,16)
InChI key:InChIKey=LYBWKEZEFCVJRY-UHFFFAOYSA-N
SMILES:C(C(NC(CCl)=O)(C)C)C1=CC(Br)=CC=C1
Synonyms:
  • N-[2-(3-Bromophenyl)-1,1-dimethylethyl]-2-chloroacetamide
  • Acetamide, N-[2-(3-bromophenyl)-1,1-dimethylethyl]-2-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.