CAS 80879-80-7
:dicyclopenta[cd,lm]perylene
Description:
Dicyclopenta[cd,lm]perylene, with the CAS number 80879-80-7, is a polycyclic aromatic hydrocarbon (PAH) characterized by its complex fused ring structure. It consists of multiple interconnected cyclopentene and perylene units, contributing to its unique electronic and optical properties. This compound is typically insoluble in water but soluble in organic solvents, which is common for many PAHs. Dicyclopenta[cd,lm]perylene exhibits strong fluorescence, making it of interest in applications such as organic light-emitting diodes (OLEDs) and organic photovoltaics. Its stability and resistance to photodegradation enhance its utility in various chemical and material science applications. Additionally, due to its aromatic nature, it may participate in π-π stacking interactions, influencing its behavior in solid-state environments. However, like many PAHs, it may pose environmental and health risks, necessitating careful handling and assessment in research and industrial contexts. Overall, dicyclopenta[cd,lm]perylene is a significant compound in the study of organic materials and their applications in advanced technologies.
Formula:C24H12
InChI:InChI=1/C24H12/c1-2-14-6-10-18-20-12-8-16-4-3-15-7-11-19(24(20)22(15)16)17-9-5-13(1)21(14)23(17)18/h1-12H
Synonyms:- Dicyclopenta(cd,lm)perylene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.