CAS 80883-02-9
:Tributyltin hydroxide
Description:
Tributyltin hydroxide (TBT hydroxide) is an organotin compound characterized by its structure, which includes three butyl groups attached to a tin atom, along with a hydroxyl group. It is typically encountered as a colorless to pale yellow liquid or solid, depending on its form and purity. TBT hydroxide is known for its biocidal properties, making it useful in various applications, particularly in antifouling paints and wood preservatives. However, due to its toxicity to aquatic organisms and potential to bioaccumulate, its use has been heavily regulated in many countries. The compound exhibits hydrophobic characteristics, which contribute to its effectiveness in marine environments. Additionally, TBT hydroxide can undergo hydrolysis, leading to the formation of other tin species. Safety precautions are essential when handling this substance, as it poses health risks, including endocrine disruption and reproductive toxicity. Overall, while TBT hydroxide has practical applications, its environmental impact necessitates careful management and adherence to regulatory guidelines.
Formula:C12H28OSn
InChI:InChI=1/3C4H9.HO.Sn/c3*1-3-4-2;;/h3*1,3-4H2,2H3;1H;/rC12H27Sn.HO/c1-4-7-10-13(11-8-5-2)12-9-6-3;/h4-12H2,1-3H3;1H
SMILES:CCCC[Sn](CCCC)CCCC.O
Synonyms:- Tributylhydroxy-tin
- Tributylhydroxy-stannane
- Tributyl-tin hydroxide
- Tributylstannanyl Hydrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.